Gamma-karoteno
γ-Karotenoa karoteno mota bat da.
| Gamma-karoteno | |
|---|---|
| Formula kimikoa | C40H56 |
| SMILES kanonikoa | 2D eredua |
| SMILES isomerikoa | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C=C(\C)/CCC=C(C)C)/C)/C |
| MolView | 3D eredua |
| Mota | A bitamina, biogenic aliphatic hydrocarbon (en)  eta Karotenoide |
| Masa molekularra | 536,438 Da |
| Erabilera | |
| Rola | vitamer (en) eta primary metabolite (en) |
| Identifikatzaileak | |
| InChlKey | HRQKOYFGHJYEFS-BXOLYSJBSA-N |
| CAS zenbakia | 472-93-5 |
| ChemSpider | 4444349 |
| PubChem | 5280791 |
| Reaxys | 2066713 |
| Gmelin | 27740 |
| KNApSAcK | C00000926 |
| UNII | DH369M0SOE |
| KEGG | C05435 |
Egitura
Tetraterpeno bat da, mutur bakarra ziklatua duena. γ-Karotenoa likopenoa ziklatuz lortzen da[1].
Belarjaleetan A bitamina bihur daiteke bigarren muturra ziklatuz eta bitan banatuz, baina bide metabolikoa oraindik ez da zehatz mehatz deskribatu.
Erreferentziak
- Biosynthesis of carotenoids in carrot: an underground story comes to light. Archives of biochemistry and biophysics, 539:110-6 or..
Ikus, gainera
Kanpo estekak
| Autoritate kontrola |
|
|---|
Datuak: Q5520255
Multimedia: Γ-Carotene / Q5520255
This article is issued from Wikipedia. The text is licensed under Creative Commons - Attribution - Sharealike. Additional terms may apply for the media files.