Alfa-karoteno
α-Karotenoa karoteno mota bat da, naturan aurkitzen den bigarren ugariena, β-Karotenoaren ondoren.
| Alfa-karoteno | |
|---|---|
 | |
| Formula kimikoa | C40H56 |
| SMILES kanonikoa | 2D eredua |
| SMILES isomerikoa | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/[C@H]2C(=CCCC2(C)C)C)/C)/C |
| MolView | 3D eredua |
| Mota | A bitamina, biogenic aliphatic hydrocarbon (en)  eta Karotenoide |
| Masa molekularra | 536,438202 Da |
| Erabilera | |
| Rola | vitamer (en) |
| Identifikatzaileak | |
| InChlKey | ANVAOWXLWRTKGA-NTXLUARGSA-N |
| CAS zenbakia | 7488-99-5 |
| ChemSpider | 4925358 |
| PubChem | 6419725 |
| Reaxys | 2067409 |
| Gmelin | 35147 |
| KNApSAcK | C00003765 |
| UNII | 45XWE1Z69V |
| KEGG | C05433 |
Egitura
Tetraterpeno bat da eta mutur batean β-ionona eta bestean α-ionona ditu.
Iturria
Honako barazki hauetan aurkitzen da[1]:
Erreferentziak
- (Ingelesez) Liu, Simin; Giles, Wayne H.; Balluz, Lina S.; Zhao, Guixiang; Ford, Earl S.; Li, Chaoyang. (2011-03-28). «Serum α-Carotene Concentrations and Risk of Death Among US Adults: The Third National Health and Nutrition Examination Survey Follow-up Study» Archives of Internal Medicine 171 (6): 507–515. doi:. ISSN 0003-9926. (Noiz kontsultatua: 2018-12-30).
Ikus, gainera
Kanpo estekak
| Autoritate kontrola |
|
|---|
Datuak: Q142871
Multimedia: Α-Carotene / Q142871
This article is issued from Wikipedia. The text is licensed under Creative Commons - Attribution - Sharealike. Additional terms may apply for the media files.